C10H11NO2 — CID 102157327
(4R)-4-benzyl-5,5-dideuterio-1,3-oxazolidin-2-one (PubChem CID 102157327) has the molecular formula C10H11NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is (4R)-4-benzyl-5,5-dideuterio-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-5,5-dideuterio-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102157327 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (4R)-4-benzyl-5,5-dideuterio-1,3-oxazolidin-2-one |
| SMILES | [2H]C1([2H])OC(=O)N[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C10H11NO2/c12-10-11-9(7-13-10)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,11,12)/t9-/m1/s1/i7D2 |
| InChIKey | OJOFMLDBXPDXLQ-VJQDKCMBSA-N |
| XLogP | 1.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |