C11H12BrNO2 — CID 91375071
4-[(4-bromophenyl)methyl]-1,3-oxazinan-2-one (PubChem CID 91375071) has the molecular formula C11H12BrNO2 and a molecular weight of 270.13 g/mol. Its IUPAC name is 4-[(4-bromophenyl)methyl]-1,3-oxazinan-2-one.
| Compound Name | 4-[(4-bromophenyl)methyl]-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 91375071 |
| Molecular Formula | C11H12BrNO2 |
| Molecular Weight | 270.13 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 4-[(4-bromophenyl)methyl]-1,3-oxazinan-2-one |
| SMILES | O=C1NC(Cc2ccc(Br)cc2)CCO1 |
| InChI | InChI=1S/C11H12BrNO2/c12-9-3-1-8(2-4-9)7-10-5-6-15-11(14)13-10/h1-4,10H,5-7H2,(H,13,14) |
| InChIKey | WLBIWGLWSBBBGM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.13 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |