C22H21NO2Si — CID 15391415
(4S)-4-(triphenylsilylmethyl)-1,3-oxazolidin-2-one (PubChem CID 15391415) has the molecular formula C22H21NO2Si and a molecular weight of 359.50 g/mol. Its IUPAC name is (4S)-4-(triphenylsilylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-(triphenylsilylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 15391415 |
| Molecular Formula | C22H21NO2Si |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | (4S)-4-(triphenylsilylmethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1N[C@H](C[Si](c2ccccc2)(c2ccccc2)c2ccccc2)CO1 |
| InChI | InChI=1S/C22H21NO2Si/c24-22-23-18(16-25-22)17-26(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-15,18H,16-17H2,(H,23,24)/t18-/m0/s1 |
| InChIKey | MCSSHPHEYLQQAO-SFHVURJKSA-N |
| XLogP | 2.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|