C32H41NO2Si2 — CID 138978332
3-[(Z)-2-triphenylsilyl-2-tri(propan-2-yl)silylethenyl]-1,3-oxazolidin-2-one (PubChem CID 138978332) has the molecular formula C32H41NO2Si2 and a molecular weight of 527.86 g/mol. Its IUPAC name is 3-[(Z)-2-triphenylsilyl-2-tri(propan-2-yl)silylethenyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(Z)-2-triphenylsilyl-2-tri(propan-2-yl)silylethenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 138978332 |
| Molecular Formula | C32H41NO2Si2 |
| Molecular Weight | 527.86 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | 3-[(Z)-2-triphenylsilyl-2-tri(propan-2-yl)silylethenyl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)[Si](/C(=C/N1CCOC1=O)[Si](c1ccccc1)(c1ccccc1)c1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C32H41NO2Si2/c1-25(2)36(26(3)4,27(5)6)31(24-33-22-23-35-32(33)34)37(28-16-10-7-11-17-28,29-18-12-8-13-19-29)30-20-14-9-15-21-30/h7-21,24-27H,22-23H2,1-6H3/b31-24- |
| InChIKey | XJARWLWJWPAVAE-QLTSDVKISA-N |
| XLogP | 6.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.86 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|