C29H25NO2Si — CID 138978331
3-[(Z)-2-phenyl-2-triphenylsilylethenyl]-1,3-oxazolidin-2-one (PubChem CID 138978331) has the molecular formula C29H25NO2Si and a molecular weight of 447.61 g/mol. Its IUPAC name is 3-[(Z)-2-phenyl-2-triphenylsilylethenyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(Z)-2-phenyl-2-triphenylsilylethenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 138978331 |
| Molecular Formula | C29H25NO2Si |
| Molecular Weight | 447.61 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 3-[(Z)-2-phenyl-2-triphenylsilylethenyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1/C=C(/c1ccccc1)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H25NO2Si/c31-29-30(21-22-32-29)23-28(24-13-5-1-6-14-24)33(25-15-7-2-8-16-25,26-17-9-3-10-18-26)27-19-11-4-12-20-27/h1-20,23H,21-22H2/b28-23- |
| InChIKey | GTMFJJDANNMNMC-NFFVHWSESA-N |
| XLogP | 4.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.61 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|