C23H20NO3P — CID 164666686
3-[(E)-2-diphenylphosphoryl-2-phenylethenyl]-1,3-oxazolidin-2-one (PubChem CID 164666686) has the molecular formula C23H20NO3P and a molecular weight of 389.39 g/mol. Its IUPAC name is 3-[(E)-2-diphenylphosphoryl-2-phenylethenyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(E)-2-diphenylphosphoryl-2-phenylethenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 164666686 |
| Molecular Formula | C23H20NO3P |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 3-[(E)-2-diphenylphosphoryl-2-phenylethenyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1/C=C(\c1ccccc1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H20NO3P/c25-23-24(16-17-27-23)18-22(19-10-4-1-5-11-19)28(26,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-15,18H,16-17H2/b22-18+ |
| InChIKey | SHJKENBGWSUITR-RELWKKBWSA-N |
| XLogP | 4.45 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|