C16H16NO3P — CID 134973982
3-(diphenylphosphorylmethyl)-1,3-oxazolidin-2-one (PubChem CID 134973982) has the molecular formula C16H16NO3P and a molecular weight of 301.28 g/mol. Its IUPAC name is 3-(diphenylphosphorylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-(diphenylphosphorylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134973982 |
| Molecular Formula | C16H16NO3P |
| Molecular Weight | 301.28 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 3-(diphenylphosphorylmethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1CP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H16NO3P/c18-16-17(11-12-20-16)13-21(19,14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10H,11-13H2 |
| InChIKey | JMJUVPXYVKQKKM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|