C19H20NO4P — CID 139256768
3-[(3R)-3-diphenylphosphorylbutanoyl]-1,3-oxazolidin-2-one (PubChem CID 139256768) has the molecular formula C19H20NO4P and a molecular weight of 357.35 g/mol. Its IUPAC name is 3-[(3R)-3-diphenylphosphorylbutanoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(3R)-3-diphenylphosphorylbutanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139256768 |
| Molecular Formula | C19H20NO4P |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 3-[(3R)-3-diphenylphosphorylbutanoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@H](CC(=O)N1CCOC1=O)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H20NO4P/c1-15(14-18(21)20-12-13-24-19(20)22)25(23,16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,15H,12-14H2,1H3/t15-/m1/s1 |
| InChIKey | JZALLSDSPUWLGY-OAHLLOKOSA-N |
| XLogP | 2.76 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|