C24H22NO4P — CID 102287464
3-(3-diphenylphosphoryl-3-phenylpropanoyl)-1,3-oxazolidin-2-one (PubChem CID 102287464) has the molecular formula C24H22NO4P and a molecular weight of 419.42 g/mol. Its IUPAC name is 3-(3-diphenylphosphoryl-3-phenylpropanoyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-(3-diphenylphosphoryl-3-phenylpropanoyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102287464 |
| Molecular Formula | C24H22NO4P |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 3-(3-diphenylphosphoryl-3-phenylpropanoyl)-1,3-oxazolidin-2-one |
| SMILES | O=C(CC(c1ccccc1)P(=O)(c1ccccc1)c1ccccc1)N1CCOC1=O |
| InChI | InChI=1S/C24H22NO4P/c26-23(25-16-17-29-24(25)27)18-22(19-10-4-1-5-11-19)30(28,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-15,22H,16-18H2 |
| InChIKey | BOAROBGLOOQPRW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|