C24H20F2NO4P — CID 139256773
3-[(3S)-3-bis(4-fluorophenyl)phosphoryl-3-phenylpropanoyl]-1,3-oxazolidin-2-one (PubChem CID 139256773) has the molecular formula C24H20F2NO4P and a molecular weight of 455.40 g/mol. Its IUPAC name is 3-[(3S)-3-bis(4-fluorophenyl)phosphoryl-3-phenylpropanoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(3S)-3-bis(4-fluorophenyl)phosphoryl-3-phenylpropanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139256773 |
| Molecular Formula | C24H20F2NO4P |
| Molecular Weight | 455.40 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 3-[(3S)-3-bis(4-fluorophenyl)phosphoryl-3-phenylpropanoyl]-1,3-oxazolidin-2-one |
| SMILES | O=C(C[C@@H](c1ccccc1)P(=O)(c1ccc(F)cc1)c1ccc(F)cc1)N1CCOC1=O |
| InChI | InChI=1S/C24H20F2NO4P/c25-18-6-10-20(11-7-18)32(30,21-12-8-19(26)9-13-21)22(17-4-2-1-3-5-17)16-23(28)27-14-15-31-24(27)29/h1-13,22H,14-16H2/t22-/m0/s1 |
| InChIKey | DOAXLJGCJUINKJ-QFIPXVFZSA-N |
| XLogP | 4.39 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|