C14H16FNO3 — CID 71098231
3-[5-(4-fluorophenyl)pentanoyl]-1,3-oxazolidin-2-one (PubChem CID 71098231) has the molecular formula C14H16FNO3 and a molecular weight of 265.28 g/mol. Its IUPAC name is 3-[5-(4-fluorophenyl)pentanoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[5-(4-fluorophenyl)pentanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 71098231 |
| Molecular Formula | C14H16FNO3 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 3-[5-(4-fluorophenyl)pentanoyl]-1,3-oxazolidin-2-one |
| SMILES | O=C(CCCCc1ccc(F)cc1)N1CCOC1=O |
| InChI | InChI=1S/C14H16FNO3/c15-12-7-5-11(6-8-12)3-1-2-4-13(17)16-9-10-19-14(16)18/h5-8H,1-4,9-10H2 |
| InChIKey | TZNXTQSHULFDLT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|