C11H10ClNO3 — CID 102525452
3-[2-(4-chlorophenyl)acetyl]-1,3-oxazolidin-2-one (PubChem CID 102525452) has the molecular formula C11H10ClNO3 and a molecular weight of 239.66 g/mol. Its IUPAC name is 3-[2-(4-chlorophenyl)acetyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-(4-chlorophenyl)acetyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102525452 |
| Molecular Formula | C11H10ClNO3 |
| Molecular Weight | 239.66 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 3-[2-(4-chlorophenyl)acetyl]-1,3-oxazolidin-2-one |
| SMILES | O=C(Cc1ccc(Cl)cc1)N1CCOC1=O |
| InChI | InChI=1S/C11H10ClNO3/c12-9-3-1-8(2-4-9)7-10(14)13-5-6-16-11(13)15/h1-4H,5-7H2 |
| InChIKey | KIADHZLQJPAATO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.66 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |