C14H17ClN2O3 — CID 131853013
3-[(3S)-3-(4-chloro-N-methylanilino)butanoyl]-1,3-oxazolidin-2-one (PubChem CID 131853013) has the molecular formula C14H17ClN2O3 and a molecular weight of 296.75 g/mol. Its IUPAC name is 3-[(3S)-3-(4-chloro-N-methylanilino)butanoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(3S)-3-(4-chloro-N-methylanilino)butanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 131853013 |
| Molecular Formula | C14H17ClN2O3 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 3-[(3S)-3-(4-chloro-N-methylanilino)butanoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@@H](CC(=O)N1CCOC1=O)N(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H17ClN2O3/c1-10(9-13(18)17-7-8-20-14(17)19)16(2)12-5-3-11(15)4-6-12/h3-6,10H,7-9H2,1-2H3/t10-/m0/s1 |
| InChIKey | GNIARPKWUKNXCL-JTQLQIEISA-N |
| XLogP | 2.53 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |