C21H28FNO4 — CID 143276417
but-1-ene;1-(4-fluorophenyl)-5-(2-oxo-1,3-oxazolidin-3-yl)pentane-1,5-dione;prop-1-ene (PubChem CID 143276417) has the molecular formula C21H28FNO4 and a molecular weight of 377.46 g/mol. Its IUPAC name is but-1-ene;1-(4-fluorophenyl)-5-(2-oxo-1,3-oxazolidin-3-yl)pentane-1,5-dione;prop-1-ene.
| Compound Name | but-1-ene;1-(4-fluorophenyl)-5-(2-oxo-1,3-oxazolidin-3-yl)pentane-1,5-dione;prop-1-ene |
|---|---|
| PubChem CID | 143276417 |
| Molecular Formula | C21H28FNO4 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | but-1-ene;1-(4-fluorophenyl)-5-(2-oxo-1,3-oxazolidin-3-yl)pentane-1,5-dione;prop-1-ene |
| SMILES | C=CC.C=CCC.O=C(CCCC(=O)N1CCOC1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H14FNO4.C4H8.C3H6/c15-11-6-4-10(5-7-11)12(17)2-1-3-13(18)16-8-9-20-14(16)19;1-3-4-2;1-3-2/h4-7H,1-3,8-9H2;3H,1,4H2,2H3;3H,1H2,2H3 |
| InChIKey | NBWYRBSOYBDOCT-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|