C12H15NO4 — CID 141382545
3-[5-(furan-3-yl)pentanoyl]-1,3-oxazolidin-2-one (PubChem CID 141382545) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is 3-[5-(furan-3-yl)pentanoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[5-(furan-3-yl)pentanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 141382545 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 3-[5-(furan-3-yl)pentanoyl]-1,3-oxazolidin-2-one |
| SMILES | O=C(CCCCc1ccoc1)N1CCOC1=O |
| InChI | InChI=1S/C12H15NO4/c14-11(13-6-8-17-12(13)15)4-2-1-3-10-5-7-16-9-10/h5,7,9H,1-4,6,8H2 |
| InChIKey | IUZSZDQKRFULHS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|