C21H19F2NO3 — CID 10915654
(4R)-4-benzyl-3-[4-(2,4-difluorophenyl)pent-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 10915654) has the molecular formula C21H19F2NO3 and a molecular weight of 371.38 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[4-(2,4-difluorophenyl)pent-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[4-(2,4-difluorophenyl)pent-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10915654 |
| Molecular Formula | C21H19F2NO3 |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | (4R)-4-benzyl-3-[4-(2,4-difluorophenyl)pent-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C=C(CCC(=O)N1C(=O)OC[C@H]1Cc1ccccc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C21H19F2NO3/c1-14(18-9-8-16(22)12-19(18)23)7-10-20(25)24-17(13-27-21(24)26)11-15-5-3-2-4-6-15/h2-6,8-9,12,17H,1,7,10-11,13H2/t17-/m1/s1 |
| InChIKey | NORWYXXQKKLDKZ-QGZVFWFLSA-N |
| XLogP | 4.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |