C25H21F3NO4P — CID 139256765
3-[(3S)-3-diphenylphosphoryl-3-[4-(trifluoromethyl)phenyl]propanoyl]-1,3-oxazolidin-2-one (PubChem CID 139256765) has the molecular formula C25H21F3NO4P and a molecular weight of 487.41 g/mol. Its IUPAC name is 3-[(3S)-3-diphenylphosphoryl-3-[4-(trifluoromethyl)phenyl]propanoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(3S)-3-diphenylphosphoryl-3-[4-(trifluoromethyl)phenyl]propanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139256765 |
| Molecular Formula | C25H21F3NO4P |
| Molecular Weight | 487.41 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 3-[(3S)-3-diphenylphosphoryl-3-[4-(trifluoromethyl)phenyl]propanoyl]-1,3-oxazolidin-2-one |
| SMILES | O=C(C[C@@H](c1ccc(C(F)(F)F)cc1)P(=O)(c1ccccc1)c1ccccc1)N1CCOC1=O |
| InChI | InChI=1S/C25H21F3NO4P/c26-25(27,28)19-13-11-18(12-14-19)22(17-23(30)29-15-16-33-24(29)31)34(32,20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-14,22H,15-17H2/t22-/m0/s1 |
| InChIKey | KBMKKQRPAGEQKH-QFIPXVFZSA-N |
| XLogP | 5.13 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.41 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|