C18H19F4NO3 — CID 134838673
3-[(1S,2R,3S,4S)-3-fluoro-2-phenyl-4-(2,2,2-trifluoroethyl)cyclohexanecarbonyl]-1,3-oxazolidin-2-one (PubChem CID 134838673) has the molecular formula C18H19F4NO3 and a molecular weight of 373.35 g/mol. Its IUPAC name is 3-[(1S,2R,3S,4S)-3-fluoro-2-phenyl-4-(2,2,2-trifluoroethyl)cyclohexanecarbonyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(1S,2R,3S,4S)-3-fluoro-2-phenyl-4-(2,2,2-trifluoroethyl)cyclohexanecarbonyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134838673 |
| Molecular Formula | C18H19F4NO3 |
| Molecular Weight | 373.35 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 3-[(1S,2R,3S,4S)-3-fluoro-2-phenyl-4-(2,2,2-trifluoroethyl)cyclohexanecarbonyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1C(=O)[C@H]1CC[C@@H](CC(F)(F)F)[C@H](F)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H19F4NO3/c19-15-12(10-18(20,21)22)6-7-13(14(15)11-4-2-1-3-5-11)16(24)23-8-9-26-17(23)25/h1-5,12-15H,6-10H2/t12-,13-,14-,15-/m0/s1 |
| InChIKey | CNONRIUSNGQEIK-AJNGGQMLSA-N |
| XLogP | 4.07 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.35 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |