C19H22NO3P — CID 10854845
ethyl 2-diphenylphosphorylpyrrolidine-1-carboxylate (PubChem CID 10854845) has the molecular formula C19H22NO3P and a molecular weight of 343.36 g/mol. Its IUPAC name is ethyl 2-diphenylphosphorylpyrrolidine-1-carboxylate.
| Compound Name | ethyl 2-diphenylphosphorylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10854845 |
| Molecular Formula | C19H22NO3P |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | ethyl 2-diphenylphosphorylpyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCCC1P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H22NO3P/c1-2-23-19(21)20-15-9-14-18(20)24(22,16-10-5-3-6-11-16)17-12-7-4-8-13-17/h3-8,10-13,18H,2,9,14-15H2,1H3 |
| InChIKey | ZOLQBFFFOMUZMB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|