C22H30NO2P — CID 4126391
N,N-dibutyl-2-diphenylphosphorylacetamide (PubChem CID 4126391) has the molecular formula C22H30NO2P and a molecular weight of 371.46 g/mol. Its IUPAC name is N,N-dibutyl-2-diphenylphosphorylacetamide.
| Compound Name | N,N-dibutyl-2-diphenylphosphorylacetamide |
|---|---|
| PubChem CID | 4126391 |
| Molecular Formula | C22H30NO2P |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | N,N-dibutyl-2-diphenylphosphorylacetamide |
| SMILES | CCCCN(CCCC)C(=O)CP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H30NO2P/c1-3-5-17-23(18-6-4-2)22(24)19-26(25,20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-16H,3-6,17-19H2,1-2H3 |
| InChIKey | SSPJHMCMDDKVPU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|