C32H33NO2P2 — CID 88907993
ethyl 4-diphenylphosphanyl-2-(diphenylphosphanylmethyl)pyrrolidine-1-carboxylate (PubChem CID 88907993) has the molecular formula C32H33NO2P2 and a molecular weight of 525.57 g/mol. Its IUPAC name is ethyl 4-diphenylphosphanyl-2-(diphenylphosphanylmethyl)pyrrolidine-1-carboxylate.
| Compound Name | ethyl 4-diphenylphosphanyl-2-(diphenylphosphanylmethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 88907993 |
| Molecular Formula | C32H33NO2P2 |
| Molecular Weight | 525.57 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | ethyl 4-diphenylphosphanyl-2-(diphenylphosphanylmethyl)pyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)N1CC(P(c2ccccc2)c2ccccc2)CC1CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H33NO2P2/c1-2-35-32(34)33-24-31(37(29-19-11-5-12-20-29)30-21-13-6-14-22-30)23-26(33)25-36(27-15-7-3-8-16-27)28-17-9-4-10-18-28/h3-22,26,31H,2,23-25H2,1H3 |
| InChIKey | YCBUAGYUKVXPJE-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.57 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|