C31H43NO2P2 — CID 14646170
methyl (2S,4S)-4-dicyclohexylphosphanyl-2-(diphenylphosphanylmethyl)pyrrolidine-1-carboxylate (PubChem CID 14646170) has the molecular formula C31H43NO2P2 and a molecular weight of 523.64 g/mol. Its IUPAC name is methyl (2S,4S)-4-dicyclohexylphosphanyl-2-(diphenylphosphanylmethyl)pyrrolidine-1-carboxylate.
| Compound Name | methyl (2S,4S)-4-dicyclohexylphosphanyl-2-(diphenylphosphanylmethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 14646170 |
| Molecular Formula | C31H43NO2P2 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | methyl (2S,4S)-4-dicyclohexylphosphanyl-2-(diphenylphosphanylmethyl)pyrrolidine-1-carboxylate |
| SMILES | COC(=O)N1C[C@@H](P(C2CCCCC2)C2CCCCC2)C[C@H]1CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H43NO2P2/c1-34-31(33)32-23-30(36(28-18-10-4-11-19-28)29-20-12-5-13-21-29)22-25(32)24-35(26-14-6-2-7-15-26)27-16-8-3-9-17-27/h2-3,6-9,14-17,25,28-30H,4-5,10-13,18-24H2,1H3/t25-,30-/m0/s1 |
| InChIKey | VOUOZIPDRAGCLI-QCDSWUKFSA-N |
| XLogP | 7.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|