C31H31NOP2 — CID 15321970
1-[(2S,4S)-4-diphenylphosphanyl-2-(diphenylphosphanylmethyl)pyrrolidin-1-yl]ethanone (PubChem CID 15321970) has the molecular formula C31H31NOP2 and a molecular weight of 495.54 g/mol. Its IUPAC name is 1-[(2S,4S)-4-diphenylphosphanyl-2-(diphenylphosphanylmethyl)pyrrolidin-1-yl]ethanone.
| Compound Name | 1-[(2S,4S)-4-diphenylphosphanyl-2-(diphenylphosphanylmethyl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 15321970 |
| Molecular Formula | C31H31NOP2 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 1-[(2S,4S)-4-diphenylphosphanyl-2-(diphenylphosphanylmethyl)pyrrolidin-1-yl]ethanone |
| SMILES | CC(=O)N1C[C@@H](P(c2ccccc2)c2ccccc2)C[C@H]1CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H31NOP2/c1-25(33)32-23-31(35(29-18-10-4-11-19-29)30-20-12-5-13-21-30)22-26(32)24-34(27-14-6-2-7-15-27)28-16-8-3-9-17-28/h2-21,26,31H,22-24H2,1H3/t26-,31-/m0/s1 |
| InChIKey | UYOGUTAKAQWDJG-HVNZXBJASA-N |
| XLogP | 5.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|