C29H29NP2 — CID 101030870
[(2S,4S)-4-diphenylphosphanyl-1-methylpyrrolidin-2-yl]-diphenylphosphane (PubChem CID 101030870) has the molecular formula C29H29NP2 and a molecular weight of 453.51 g/mol. Its IUPAC name is [(2S,4S)-4-diphenylphosphanyl-1-methylpyrrolidin-2-yl]-diphenylphosphane.
| Compound Name | [(2S,4S)-4-diphenylphosphanyl-1-methylpyrrolidin-2-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 101030870 |
| Molecular Formula | C29H29NP2 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | [(2S,4S)-4-diphenylphosphanyl-1-methylpyrrolidin-2-yl]-diphenylphosphane |
| SMILES | CN1C[C@@H](P(c2ccccc2)c2ccccc2)C[C@@H]1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H29NP2/c1-30-23-28(31(24-14-6-2-7-15-24)25-16-8-3-9-17-25)22-29(30)32(26-18-10-4-11-19-26)27-20-12-5-13-21-27/h2-21,28-29H,22-23H2,1H3/t28-,29-/m0/s1 |
| InChIKey | GJMMGUCIACLVBO-VMPREFPWSA-N |
| XLogP | 5.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|