C43H42NOP3 — CID 57179888
[(3S,5S)-1-bis(3-methylphenyl)phosphoryl-5-(diphenylphosphanylmethyl)pyrrolidin-3-yl]-diphenylphosphane (PubChem CID 57179888) has the molecular formula C43H42NOP3 and a molecular weight of 681.74 g/mol. Its IUPAC name is [(3S,5S)-1-bis(3-methylphenyl)phosphoryl-5-(diphenylphosphanylmethyl)pyrrolidin-3-yl]-diphenylphosphane.
| Compound Name | [(3S,5S)-1-bis(3-methylphenyl)phosphoryl-5-(diphenylphosphanylmethyl)pyrrolidin-3-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 57179888 |
| Molecular Formula | C43H42NOP3 |
| Molecular Weight | 681.74 g/mol |
| Exact Mass | 681.25 |
| IUPAC Name | [(3S,5S)-1-bis(3-methylphenyl)phosphoryl-5-(diphenylphosphanylmethyl)pyrrolidin-3-yl]-diphenylphosphane |
| SMILES | Cc1cccc(P(=O)(c2cccc(C)c2)N2C[C@@H](P(c3ccccc3)c3ccccc3)C[C@H]2CP(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C43H42NOP3/c1-34-17-15-27-42(29-34)48(45,43-28-16-18-35(2)30-43)44-32-41(47(39-23-11-5-12-24-39)40-25-13-6-14-26-40)31-36(44)33-46(37-19-7-3-8-20-37)38-21-9-4-10-22-38/h3-30,36,41H,31-33H2,1-2H3/t36-,41-/m0/s1 |
| InChIKey | NEKGSKXDNREZDX-ASVWIKLXSA-N |
| XLogP | 8.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.74 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|