C30H31NO2P2S — CID 10744809
[(3S,5S)-5-(diphenylphosphanylmethyl)-1-methylsulfonylpyrrolidin-3-yl]-diphenylphosphane (PubChem CID 10744809) has the molecular formula C30H31NO2P2S and a molecular weight of 531.60 g/mol. Its IUPAC name is [(3S,5S)-5-(diphenylphosphanylmethyl)-1-methylsulfonylpyrrolidin-3-yl]-diphenylphosphane.
| Compound Name | [(3S,5S)-5-(diphenylphosphanylmethyl)-1-methylsulfonylpyrrolidin-3-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 10744809 |
| Molecular Formula | C30H31NO2P2S |
| Molecular Weight | 531.60 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | [(3S,5S)-5-(diphenylphosphanylmethyl)-1-methylsulfonylpyrrolidin-3-yl]-diphenylphosphane |
| SMILES | CS(=O)(=O)N1C[C@@H](P(c2ccccc2)c2ccccc2)C[C@H]1CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H31NO2P2S/c1-36(32,33)31-23-30(35(28-18-10-4-11-19-28)29-20-12-5-13-21-29)22-25(31)24-34(26-14-6-2-7-15-26)27-16-8-3-9-17-27/h2-21,25,30H,22-24H2,1H3/t25-,30-/m0/s1 |
| InChIKey | ZSRKOFHQDCEHCF-QCDSWUKFSA-N |
| XLogP | 4.65 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.60 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|