C24H35NO3PSSi — CID 67917543
CID 67917543 (PubChem CID 67917543) has the molecular formula C24H35NO3PSSi and a molecular weight of 476.68 g/mol.
| Compound Name | CID 67917543 |
|---|---|
| PubChem CID | 67917543 |
| Molecular Formula | C24H35NO3PSSi |
| Molecular Weight | 476.68 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | — |
| SMILES | C[Si](C)OC[C@@]1(C(C)(C)C)C[C@H](P(c2ccccc2)c2ccccc2)CN1S(C)(=O)=O |
| InChI | InChI=1S/C24H35NO3PSSi/c1-23(2,3)24(19-28-31(5)6)17-22(18-25(24)30(4,26)27)29(20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-16,22H,17-19H2,1-6H3/t22-,24+/m0/s1 |
| InChIKey | JQDXEEJSNWRDGI-LADGPHEKSA-N |
| XLogP | 4.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.68 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|