C46H46NO2P3 — CID 23176947
tert-butyl 2,4-bis(diphenylphosphanyl)-2-(diphenylphosphanylmethyl)pyrrolidine-1-carboxylate (PubChem CID 23176947) has the molecular formula C46H46NO2P3 and a molecular weight of 737.80 g/mol. Its IUPAC name is tert-butyl 2,4-bis(diphenylphosphanyl)-2-(diphenylphosphanylmethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2,4-bis(diphenylphosphanyl)-2-(diphenylphosphanylmethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 23176947 |
| Molecular Formula | C46H46NO2P3 |
| Molecular Weight | 737.80 g/mol |
| Exact Mass | 737.27 |
| IUPAC Name | tert-butyl 2,4-bis(diphenylphosphanyl)-2-(diphenylphosphanylmethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(P(c2ccccc2)c2ccccc2)CC1(CP(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C46H46NO2P3/c1-45(2,3)49-44(48)47-35-43(51(39-26-14-6-15-27-39)40-28-16-7-17-29-40)34-46(47,52(41-30-18-8-19-31-41)42-32-20-9-21-33-42)36-50(37-22-10-4-11-23-37)38-24-12-5-13-25-38/h4-33,43H,34-36H2,1-3H3 |
| InChIKey | UBVIWZOYPJJDHX-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.80 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|