C35H33NO3P2S — CID 88678056
(2S,4S)-4-diphenylphosphanyl-2-(diphenylphosphanylmethyl)-2-phenylpyrrolidine-1-sulfonic acid (PubChem CID 88678056) has the molecular formula C35H33NO3P2S and a molecular weight of 609.67 g/mol. Its IUPAC name is (2S,4S)-4-diphenylphosphanyl-2-(diphenylphosphanylmethyl)-2-phenylpyrrolidine-1-sulfonic acid.
| Compound Name | (2S,4S)-4-diphenylphosphanyl-2-(diphenylphosphanylmethyl)-2-phenylpyrrolidine-1-sulfonic acid |
|---|---|
| PubChem CID | 88678056 |
| Molecular Formula | C35H33NO3P2S |
| Molecular Weight | 609.67 g/mol |
| Exact Mass | 609.17 |
| IUPAC Name | (2S,4S)-4-diphenylphosphanyl-2-(diphenylphosphanylmethyl)-2-phenylpyrrolidine-1-sulfonic acid |
| SMILES | O=S(=O)(O)N1C[C@@H](P(c2ccccc2)c2ccccc2)C[C@@]1(CP(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H33NO3P2S/c37-42(38,39)36-27-34(41(32-22-12-4-13-23-32)33-24-14-5-15-25-33)26-35(36,29-16-6-1-7-17-29)28-40(30-18-8-2-9-19-30)31-20-10-3-11-21-31/h1-25,34H,26-28H2,(H,37,38,39)/t34-,35+/m0/s1 |
| InChIKey | XMCACIRLMNWGFK-OIDHKYIRSA-N |
| XLogP | 6.02 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.67 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|