C27H35N2O3P — CID 70877080
tert-butyl 4-diphenylphosphanyl-2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)pyrrolidine-1-carboxylate (PubChem CID 70877080) has the molecular formula C27H35N2O3P and a molecular weight of 466.56 g/mol. Its IUPAC name is tert-butyl 4-diphenylphosphanyl-2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4-diphenylphosphanyl-2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 70877080 |
| Molecular Formula | C27H35N2O3P |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | tert-butyl 4-diphenylphosphanyl-2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)C1COC(C2CC(P(c3ccccc3)c3ccccc3)CN2C(=O)OC(C)(C)C)=N1 |
| InChI | InChI=1S/C27H35N2O3P/c1-19(2)23-18-31-25(28-23)24-16-22(17-29(24)26(30)32-27(3,4)5)33(20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,19,22-24H,16-18H2,1-5H3 |
| InChIKey | HSOYJNXQRUNDQN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|