C22H26NO4P — CID 139256770
3-[(3R)-3-diphenylphosphoryl-5-methylhexanoyl]-1,3-oxazolidin-2-one (PubChem CID 139256770) has the molecular formula C22H26NO4P and a molecular weight of 399.43 g/mol. Its IUPAC name is 3-[(3R)-3-diphenylphosphoryl-5-methylhexanoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(3R)-3-diphenylphosphoryl-5-methylhexanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139256770 |
| Molecular Formula | C22H26NO4P |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 3-[(3R)-3-diphenylphosphoryl-5-methylhexanoyl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)C[C@H](CC(=O)N1CCOC1=O)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H26NO4P/c1-17(2)15-20(16-21(24)23-13-14-27-22(23)25)28(26,18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-12,17,20H,13-16H2,1-2H3/t20-/m1/s1 |
| InChIKey | GULCMQSBRIOAPB-HXUWFJFHSA-N |
| XLogP | 3.78 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|