C21H24NO4P — CID 139256769
3-[(3S)-3-diphenylphosphoryl-4-methylpentanoyl]-1,3-oxazolidin-2-one (PubChem CID 139256769) has the molecular formula C21H24NO4P and a molecular weight of 385.40 g/mol. Its IUPAC name is 3-[(3S)-3-diphenylphosphoryl-4-methylpentanoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(3S)-3-diphenylphosphoryl-4-methylpentanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139256769 |
| Molecular Formula | C21H24NO4P |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 3-[(3S)-3-diphenylphosphoryl-4-methylpentanoyl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)[C@H](CC(=O)N1CCOC1=O)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H24NO4P/c1-16(2)19(15-20(23)22-13-14-26-21(22)24)27(25,17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,16,19H,13-15H2,1-2H3/t19-/m0/s1 |
| InChIKey | ZHDCWHCUFPYRFH-IBGZPJMESA-N |
| XLogP | 3.39 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|