About 3-[(2-oxo-1,3-oxazolidin-3-yl)-phenylphosphoryl]-1,3-oxazolidin-2-one
3-[(2-oxo-1,3-oxazolidin-3-yl)-phenylphosphoryl]-1,3-oxazolidin-2-one (PubChem CID 142711303) has the molecular formula C12H13N2O5P
and a molecular weight of 296.22 g/mol. Its IUPAC name is 3-[(2-oxo-1,3-oxazolidin-3-yl)-phenylphosphoryl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-[(2-oxo-1,3-oxazolidin-3-yl)-phenylphosphoryl]-1,3-oxazolidin-2-one |
| PubChem CID | 142711303 |
| Molecular Formula | C12H13N2O5P |
| Molecular Weight | 296.22 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 3-[(2-oxo-1,3-oxazolidin-3-yl)-phenylphosphoryl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1P(=O)(c1ccccc1)N1CCOC1=O |
| InChI | InChI=1S/C12H13N2O5P/c15-11-13(6-8-18-11)20(17,10-4-2-1-3-5-10)14-7-9-19-12(14)16/h1-5H,6-9H2 |
| InChIKey | CMCZIGTXIVBHFS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-oxo-1,3-oxazolidin-3-yl)-phenylphosphoryl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-oxo-1,3-oxazolidin-3-yl)-phenylphosphoryl]-1,3-oxazolidin-2-one?
The IUPAC name of 3-[(2-oxo-1,3-oxazolidin-3-yl)-phenylphosphoryl]-1,3-oxazolidin-2-one (CID 142711303) is 3-[(2-oxo-1,3-oxazolidin-3-yl)-phenylphosphoryl]-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-[(2-oxo-1,3-oxazolidin-3-yl)-phenylphosphoryl]-1,3-oxazolidin-2-one?
The canonical SMILES for 3-[(2-oxo-1,3-oxazolidin-3-yl)-phenylphosphoryl]-1,3-oxazolidin-2-one is O=C1OCCN1P(=O)(c1ccccc1)N1CCOC1=O.
What is the InChIKey of 3-[(2-oxo-1,3-oxazolidin-3-yl)-phenylphosphoryl]-1,3-oxazolidin-2-one?
The InChIKey is CMCZIGTXIVBHFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N2O5P/c15-11-13(6-8-18-11)20(17,10-4-2-1-3-5-10)14-7-9-19-12(14)16/h1-5H,6-9H2.
What are the key properties of 3-[(2-oxo-1,3-oxazolidin-3-yl)-phenylphosphoryl]-1,3-oxazolidin-2-one?
3-[(2-oxo-1,3-oxazolidin-3-yl)-phenylphosphoryl]-1,3-oxazolidin-2-one has a molecular weight of 296.22 g/mol, XLogP of 1.41, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-oxo-1,3-oxazolidin-3-yl)-phenylphosphoryl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 142711303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).