C16H17NO2 — CID 134965374
3-[(Z)-[(2S)-2-phenylcyclohex-3-en-1-ylidene]methyl]-1,3-oxazolidin-2-one (PubChem CID 134965374) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 3-[(Z)-[(2S)-2-phenylcyclohex-3-en-1-ylidene]methyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(Z)-[(2S)-2-phenylcyclohex-3-en-1-ylidene]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134965374 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 3-[(Z)-[(2S)-2-phenylcyclohex-3-en-1-ylidene]methyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1/C=C1/CCC=C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H17NO2/c18-16-17(10-11-19-16)12-14-8-4-5-9-15(14)13-6-2-1-3-7-13/h1-3,5-7,9,12,15H,4,8,10-11H2/b14-12-/t15-/m0/s1 |
| InChIKey | LLNNNDVIHSTQPB-ZSMUJPCHSA-N |
| XLogP | 3.46 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|