C24H20ClNO2 — CID 132605301
3-[(Z)-1-chloro-2,3,3-triphenylprop-1-enyl]-1,3-oxazolidin-2-one (PubChem CID 132605301) has the molecular formula C24H20ClNO2 and a molecular weight of 389.88 g/mol. Its IUPAC name is 3-[(Z)-1-chloro-2,3,3-triphenylprop-1-enyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(Z)-1-chloro-2,3,3-triphenylprop-1-enyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 132605301 |
| Molecular Formula | C24H20ClNO2 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 3-[(Z)-1-chloro-2,3,3-triphenylprop-1-enyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1/C(Cl)=C(/c1ccccc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H20ClNO2/c25-23(26-16-17-28-24(26)27)22(20-14-8-3-9-15-20)21(18-10-4-1-5-11-18)19-12-6-2-7-13-19/h1-15,21H,16-17H2/b23-22- |
| InChIKey | MOCUPVYBKFXAHW-FCQUAONHSA-N |
| XLogP | 5.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|