C36H42N2O4 — CID 139043007
3-[(Z)-[(2R,6S)-3,6-dimethyl-2-phenylcyclohex-3-en-1-ylidene]methyl]-1,3-oxazolidin-2-one;3-[(Z)-[(2S,6R)-3,6-dimethyl-2-phenylcyclohex-3-en-1-ylidene]methyl]-1,3-oxazolidin-2-one (PubChem CID 139043007) has the molecular formula C36H42N2O4 and a molecular weight of 566.74 g/mol. Its IUPAC name is 3-[(Z)-[(2R,6S)-3,6-dimethyl-2-phenylcyclohex-3-en-1-ylidene]methyl]-1,3-oxazolidin-2-one;3-[(Z)-[(2S,6R)-3,6-dimethyl-2-phenylcyclohex-3-en-1-ylidene]methyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(Z)-[(2R,6S)-3,6-dimethyl-2-phenylcyclohex-3-en-1-ylidene]methyl]-1,3-oxazolidin-2-one;3-[(Z)-[(2S,6R)-3,6-dimethyl-2-phenylcyclohex-3-en-1-ylidene]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139043007 |
| Molecular Formula | C36H42N2O4 |
| Molecular Weight | 566.74 g/mol |
| Exact Mass | 566.31 |
| IUPAC Name | 3-[(Z)-[(2R,6S)-3,6-dimethyl-2-phenylcyclohex-3-en-1-ylidene]methyl]-1,3-oxazolidin-2-one;3-[(Z)-[(2S,6R)-3,6-dimethyl-2-phenylcyclohex-3-en-1-ylidene]methyl]-1,3-oxazolidin-2-one |
| SMILES | CC1=CC[C@@H](C)/C(=C/N2CCOC2=O)[C@@H]1c1ccccc1.CC1=CC[C@H](C)/C(=C/N2CCOC2=O)[C@H]1c1ccccc1 |
| InChI | InChI=1S/2C18H21NO2/c2*1-13-8-9-14(2)17(15-6-4-3-5-7-15)16(13)12-19-10-11-21-18(19)20/h2*3-7,9,12-13,17H,8,10-11H2,1-2H3/b2*16-12-/t2*13-,17+/m10/s1 |
| InChIKey | SPPVHZSSAWXZPX-JOCKKLGTSA-N |
| XLogP | 8.18 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.74 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|