C40H42N2O4 — CID 139043349
(4S)-3-[(E,3R)-2,3-diphenylbut-1-enyl]-4-methyl-1,3-oxazolidin-2-one;(4S)-3-[(E,3S)-2,3-diphenylbut-1-enyl]-4-methyl-1,3-oxazolidin-2-one (PubChem CID 139043349) has the molecular formula C40H42N2O4 and a molecular weight of 614.79 g/mol. Its IUPAC name is (4S)-3-[(E,3R)-2,3-diphenylbut-1-enyl]-4-methyl-1,3-oxazolidin-2-one;(4S)-3-[(E,3S)-2,3-diphenylbut-1-enyl]-4-methyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(E,3R)-2,3-diphenylbut-1-enyl]-4-methyl-1,3-oxazolidin-2-one;(4S)-3-[(E,3S)-2,3-diphenylbut-1-enyl]-4-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139043349 |
| Molecular Formula | C40H42N2O4 |
| Molecular Weight | 614.79 g/mol |
| Exact Mass | 614.31 |
| IUPAC Name | (4S)-3-[(E,3R)-2,3-diphenylbut-1-enyl]-4-methyl-1,3-oxazolidin-2-one;(4S)-3-[(E,3S)-2,3-diphenylbut-1-enyl]-4-methyl-1,3-oxazolidin-2-one |
| SMILES | C[C@@H](/C(=C\N1C(=O)OC[C@@H]1C)c1ccccc1)c1ccccc1.C[C@H](/C(=C\N1C(=O)OC[C@@H]1C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C20H21NO2/c2*1-15-14-23-20(22)21(15)13-19(18-11-7-4-8-12-18)16(2)17-9-5-3-6-10-17/h2*3-13,15-16H,14H2,1-2H3/b2*19-13+/t15-,16+;15-,16-/m00/s1 |
| InChIKey | UIWLCYNAWCBRJQ-SCAUVXRWSA-N |
| XLogP | 9.34 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.79 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |