C16H25NO2Si2 — CID 134848274
3-[(E)-2-[dimethyl(phenyl)silyl]-2-trimethylsilylethenyl]-1,3-oxazolidin-2-one (PubChem CID 134848274) has the molecular formula C16H25NO2Si2 and a molecular weight of 319.55 g/mol. Its IUPAC name is 3-[(E)-2-[dimethyl(phenyl)silyl]-2-trimethylsilylethenyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(E)-2-[dimethyl(phenyl)silyl]-2-trimethylsilylethenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134848274 |
| Molecular Formula | C16H25NO2Si2 |
| Molecular Weight | 319.55 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 3-[(E)-2-[dimethyl(phenyl)silyl]-2-trimethylsilylethenyl]-1,3-oxazolidin-2-one |
| SMILES | C[Si](C)(C)/C(=C\N1CCOC1=O)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C16H25NO2Si2/c1-20(2,3)15(13-17-11-12-19-16(17)18)21(4,5)14-9-7-6-8-10-14/h6-10,13H,11-12H2,1-5H3/b15-13+ |
| InChIKey | ACOPKWNHFRQOIS-FYWRMAATSA-N |
| XLogP | 3.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.55 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|