C18H31NO3Si — CID 123715889
tert-butyl N-[2-[tert-butyl(phenyl)silyl]oxyethyl]-N-methylcarbamate (PubChem CID 123715889) has the molecular formula C18H31NO3Si and a molecular weight of 337.54 g/mol. Its IUPAC name is tert-butyl N-[2-[tert-butyl(phenyl)silyl]oxyethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[tert-butyl(phenyl)silyl]oxyethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 123715889 |
| Molecular Formula | C18H31NO3Si |
| Molecular Weight | 337.54 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | tert-butyl N-[2-[tert-butyl(phenyl)silyl]oxyethyl]-N-methylcarbamate |
| SMILES | CN(CCO[SiH](c1ccccc1)C(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H31NO3Si/c1-17(2,3)22-16(20)19(7)13-14-21-23(18(4,5)6)15-11-9-8-10-12-15/h8-12,23H,13-14H2,1-7H3 |
| InChIKey | IEAFHLNTJMFHAR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|