C12H17NO2Si — CID 139263752
(4S)-4-[[dimethyl(phenyl)silyl]methyl]-1,3-oxazolidin-2-one (PubChem CID 139263752) has the molecular formula C12H17NO2Si and a molecular weight of 235.36 g/mol. Its IUPAC name is (4S)-4-[[dimethyl(phenyl)silyl]methyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-[[dimethyl(phenyl)silyl]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139263752 |
| Molecular Formula | C12H17NO2Si |
| Molecular Weight | 235.36 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | (4S)-4-[[dimethyl(phenyl)silyl]methyl]-1,3-oxazolidin-2-one |
| SMILES | C[Si](C)(C[C@@H]1COC(=O)N1)c1ccccc1 |
| InChI | InChI=1S/C12H17NO2Si/c1-16(2,11-6-4-3-5-7-11)9-10-8-15-12(14)13-10/h3-7,10H,8-9H2,1-2H3,(H,13,14)/t10-/m0/s1 |
| InChIKey | VKDJQHCKWLAVRX-JTQLQIEISA-N |
| XLogP | 1.71 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|