C17H27NO4Si — CID 132559588
methyl 3-[dimethyl(phenyl)silyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 132559588) has the molecular formula C17H27NO4Si and a molecular weight of 337.49 g/mol. Its IUPAC name is methyl 3-[dimethyl(phenyl)silyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | methyl 3-[dimethyl(phenyl)silyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 132559588 |
| Molecular Formula | C17H27NO4Si |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | methyl 3-[dimethyl(phenyl)silyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COC(=O)C(C[Si](C)(C)c1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H27NO4Si/c1-17(2,3)22-16(20)18-14(15(19)21-4)12-23(5,6)13-10-8-7-9-11-13/h7-11,14H,12H2,1-6H3,(H,18,20) |
| InChIKey | BXYXQIAHBGUSOM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|