C25H33NO4Si — CID 10741724
(E,2R)-4-[tert-butyl(diphenyl)silyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoic acid (PubChem CID 10741724) has the molecular formula C25H33NO4Si and a molecular weight of 439.63 g/mol. Its IUPAC name is (E,2R)-4-[tert-butyl(diphenyl)silyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoic acid.
| Compound Name | (E,2R)-4-[tert-butyl(diphenyl)silyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoic acid |
|---|---|
| PubChem CID | 10741724 |
| Molecular Formula | C25H33NO4Si |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | (E,2R)-4-[tert-butyl(diphenyl)silyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@H](/C=C/[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C25H33NO4Si/c1-24(2,3)30-23(29)26-21(22(27)28)17-18-31(25(4,5)6,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-18,21H,1-6H3,(H,26,29)(H,27,28)/b18-17+/t21-/m1/s1 |
| InChIKey | QOMPPLAGYHEWMX-RURFIKTLSA-N |
| XLogP | 4.12 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|