C22H29NO4Si — CID 102121987
methyl (2S)-3-[methyl(diphenyl)silyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 102121987) has the molecular formula C22H29NO4Si and a molecular weight of 399.56 g/mol. Its IUPAC name is methyl (2S)-3-[methyl(diphenyl)silyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | methyl (2S)-3-[methyl(diphenyl)silyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 102121987 |
| Molecular Formula | C22H29NO4Si |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | methyl (2S)-3-[methyl(diphenyl)silyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COC(=O)[C@@H](C[Si](C)(c1ccccc1)c1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H29NO4Si/c1-22(2,3)27-21(25)23-19(20(24)26-4)16-28(5,17-12-8-6-9-13-17)18-14-10-7-11-15-18/h6-15,19H,16H2,1-5H3,(H,23,25)/t19-/m1/s1 |
| InChIKey | HSDCXEQOHZDKDR-LJQANCHMSA-N |
| XLogP | 2.95 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|