C15H21NO4Se — CID 11523310
methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylselanylpropanoate (PubChem CID 11523310) has the molecular formula C15H21NO4Se and a molecular weight of 358.30 g/mol. Its IUPAC name is methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylselanylpropanoate.
| Compound Name | methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylselanylpropanoate |
|---|---|
| PubChem CID | 11523310 |
| Molecular Formula | C15H21NO4Se |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylselanylpropanoate |
| SMILES | COC(=O)[C@H](C[Se]c1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H21NO4Se/c1-15(2,3)20-14(18)16-12(13(17)19-4)10-21-11-8-6-5-7-9-11/h5-9,12H,10H2,1-4H3,(H,16,18)/t12-/m0/s1 |
| InChIKey | GFWRNOHIZKNLRX-LBPRGKRZSA-N |
| XLogP | 1.50 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|