C16H23NO4Se — CID 72999342
methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylselanylbutanoate (PubChem CID 72999342) has the molecular formula C16H23NO4Se and a molecular weight of 372.32 g/mol. Its IUPAC name is methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylselanylbutanoate.
| Compound Name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylselanylbutanoate |
|---|---|
| PubChem CID | 72999342 |
| Molecular Formula | C16H23NO4Se |
| Molecular Weight | 372.32 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylselanylbutanoate |
| SMILES | COC(=O)C(NC(=O)OC(C)(C)C)C(C)[Se]c1ccccc1 |
| InChI | InChI=1S/C16H23NO4Se/c1-11(22-12-9-7-6-8-10-12)13(14(18)20-5)17-15(19)21-16(2,3)4/h6-11,13H,1-5H3,(H,17,19) |
| InChIKey | FJMSNGMXDKFTMF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|