C16H25NO2Se — CID 24874554
tert-butyl N-[(2S)-3-methyl-1-phenylselanylbutan-2-yl]carbamate (PubChem CID 24874554) has the molecular formula C16H25NO2Se and a molecular weight of 342.34 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-methyl-1-phenylselanylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-methyl-1-phenylselanylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 24874554 |
| Molecular Formula | C16H25NO2Se |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | tert-butyl N-[(2S)-3-methyl-1-phenylselanylbutan-2-yl]carbamate |
| SMILES | CC(C)[C@@H](C[Se]c1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25NO2Se/c1-12(2)14(17-15(18)19-16(3,4)5)11-20-13-9-7-6-8-10-13/h6-10,12,14H,11H2,1-5H3,(H,17,18)/t14-/m1/s1 |
| InChIKey | KOYQAOLZKKVPHR-CQSZACIVSA-N |
| XLogP | 2.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|