C16H22ClNO4Se — CID 11517049
methyl (2R,3R)-3-(4-chlorophenyl)selanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 11517049) has the molecular formula C16H22ClNO4Se and a molecular weight of 406.77 g/mol. Its IUPAC name is methyl (2R,3R)-3-(4-chlorophenyl)selanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | methyl (2R,3R)-3-(4-chlorophenyl)selanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 11517049 |
| Molecular Formula | C16H22ClNO4Se |
| Molecular Weight | 406.77 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | methyl (2R,3R)-3-(4-chlorophenyl)selanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | COC(=O)[C@@H](NC(=O)OC(C)(C)C)[C@@H](C)[Se]c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H22ClNO4Se/c1-10(23-12-8-6-11(17)7-9-12)13(14(19)21-5)18-15(20)22-16(2,3)4/h6-10,13H,1-5H3,(H,18,20)/t10-,13+/m1/s1 |
| InChIKey | VZONTMFTTHOEDT-MFKMUULPSA-N |
| XLogP | 2.54 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.77 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|