C21H26NO4P — CID 23630943
methyl (2R)-3-diphenylphosphanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 23630943) has the molecular formula C21H26NO4P and a molecular weight of 387.42 g/mol. Its IUPAC name is methyl (2R)-3-diphenylphosphanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | methyl (2R)-3-diphenylphosphanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 23630943 |
| Molecular Formula | C21H26NO4P |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | methyl (2R)-3-diphenylphosphanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COC(=O)[C@H](CP(c1ccccc1)c1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H26NO4P/c1-21(2,3)26-20(24)22-18(19(23)25-4)15-27(16-11-7-5-8-12-16)17-13-9-6-10-14-17/h5-14,18H,15H2,1-4H3,(H,22,24)/t18-/m0/s1 |
| InChIKey | IEENFDPQDXKSEI-SFHVURJKSA-N |
| XLogP | 3.19 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|