C22H30NO2P — CID 15145877
tert-butyl N-[(2S)-1-diphenylphosphanyl-3-methylbutan-2-yl]carbamate (PubChem CID 15145877) has the molecular formula C22H30NO2P and a molecular weight of 371.46 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-diphenylphosphanyl-3-methylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-diphenylphosphanyl-3-methylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 15145877 |
| Molecular Formula | C22H30NO2P |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | tert-butyl N-[(2S)-1-diphenylphosphanyl-3-methylbutan-2-yl]carbamate |
| SMILES | CC(C)[C@@H](CP(c1ccccc1)c1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H30NO2P/c1-17(2)20(23-21(24)25-22(3,4)5)16-26(18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15,17,20H,16H2,1-5H3,(H,23,24)/t20-/m1/s1 |
| InChIKey | BIMQNJOVDDUOFL-HXUWFJFHSA-N |
| XLogP | 4.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|