C22H28NO4PS — CID 134864742
methyl (2R)-3-diphenylphosphinothioyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 134864742) has the molecular formula C22H28NO4PS and a molecular weight of 433.51 g/mol. Its IUPAC name is methyl (2R)-3-diphenylphosphinothioyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | methyl (2R)-3-diphenylphosphinothioyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 134864742 |
| Molecular Formula | C22H28NO4PS |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | methyl (2R)-3-diphenylphosphinothioyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | COC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)P(=S)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H28NO4PS/c1-16(19(20(24)26-5)23-21(25)27-22(2,3)4)28(29,17-12-8-6-9-13-17)18-14-10-7-11-15-18/h6-16,19H,1-5H3,(H,23,25)/t16?,19-/m0/s1 |
| InChIKey | CHEDJIAGRQEHDH-CVMIBEPCSA-N |
| XLogP | 3.57 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|